CAS 1332531-54-0

5-Thiazolemethanamine, N-cyclopropyl-, hydrochloride (1:2)

Description:

5-Thiazolemethanamine, N-cyclopropyl-, hydrochloride (1:2) is a chemical compound characterized by its thiazole ring structure, which contributes to its heterocyclic properties. The presence of the cyclopropyl group enhances its potential for biological activity, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical formulations. The compound may exhibit various pharmacological properties, potentially acting as a ligand or modulator in biological systems. Its molecular structure suggests that it could participate in hydrogen bonding and other interactions, influencing its reactivity and stability. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a unique combination of structural features that may lead to interesting applications in drug development and other fields of chemistry.

Formula: C₇H₁₀N₂S·2ClH

InChI: InChI=1S/C7H10N2S.2ClH/c1-2-6(1)9-4-7-3-8-5-10-7;;/h3,5-6,9H,1-2,4H2;2*1H

InChI key: InChIKey=VQUGKALEENKTAT-UHFFFAOYSA-N

SMILES: N(CC1=CN=CS1)C2CC2.Cl

Synonyms:

• 5-Thiazolemethanamine, N-cyclopropyl-, hydrochloride (1:2)