CAS 1332531-55-1

Benzamide, N-(1-methylethyl)-4-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1)

Description:

Benzamide, N-(1-methylethyl)-4-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1) is a chemical compound characterized by its benzamide structure, which features a benzene ring attached to an amide functional group. The presence of a 1-methylethyl group indicates a branched alkyl substituent, contributing to its hydrophobic characteristics. Additionally, the compound contains a pyrrolidinylmethoxy group, which suggests the presence of a pyrrolidine ring linked to a methoxy group, enhancing its potential for interactions with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit various biological activities, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and biological activity, would depend on the precise molecular interactions and the environment in which it is studied. Overall, this compound's unique structure suggests potential utility in drug development and research.

Formula: C₁₅H₂₂N₂O₂·ClH

InChI: InChI=1S/C15H22N2O2.ClH/c1-11(2)17-15(18)12-5-7-14(8-6-12)19-10-13-4-3-9-16-13;/h5-8,11,13,16H,3-4,9-10H2,1-2H3,(H,17,18);1H

InChI key: InChIKey=IKAUEYDKYRVFRB-UHFFFAOYSA-N

SMILES: C(NC(C)C)(=O)C1=CC=C(OCC2CCCN2)C=C1.Cl

Synonyms:

• Benzamide, N-(1-methylethyl)-4-(2-pyrrolidinylmethoxy)-, hydrochloride (1:1)