
CAS 133256-59-4
:1,5,9-Trimethyl-1,5,9-triazacyclododecane
Description:
1,5,9-Trimethyl-1,5,9-triazacyclododecane, commonly referred to as TMTACD, is a cyclic polyamine characterized by its unique structure that includes three methyl groups and a twelve-membered ring containing three nitrogen atoms. This compound exhibits a high degree of flexibility and can form stable complexes with various metal ions, making it of interest in coordination chemistry and potential applications in catalysis and separation processes. TMTACD is soluble in polar solvents, which enhances its utility in various chemical environments. Its triazacyclododecane framework contributes to its ability to act as a ligand, facilitating interactions with transition metals and influencing their reactivity. Additionally, the presence of methyl groups can affect the steric and electronic properties of the molecule, potentially enhancing its selectivity in binding. Overall, TMTACD is a versatile compound with significant implications in both theoretical and applied chemistry, particularly in the fields of coordination chemistry and materials science.
Formula:C12H27N3
InChI:InChI=1S/C12H27N3/c1-13-7-4-9-14(2)11-6-12-15(3)10-5-8-13/h4-12H2,1-3H3
InChI key:InChIKey=LRPVVAOGGZFVFO-UHFFFAOYSA-N
SMILES:CN1CCCN(C)CCCN(C)CCC1
Synonyms:- 1,5,9-Trimethyl-1,5,9-triazacyclododecane
- N,N′,N′′-Trimethyl-1,5,9-triazacyclododecane
- 1,5,9-Trimethyl-1,5,9-triazacyclododecan
- 1,5,9-Triazacyclododecane, 1,5,9-trimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
