CymitQuimica logo

CAS 1332634-91-9

:

N1-(4-Chlorophenyl)-N2-(5-fluoro-2,4-dinitrophenyl)-1,2-benzenediamine

Description:
N1-(4-Chlorophenyl)-N2-(5-fluoro-2,4-dinitrophenyl)-1,2-benzenediamine, identified by its CAS number 1332634-91-9, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups. This compound features a benzenediamine backbone, which is substituted with a 4-chlorophenyl group and a 5-fluoro-2,4-dinitrophenyl moiety. The presence of chlorine and fluorine atoms contributes to its unique electronic properties and potential reactivity. Typically, compounds of this nature may exhibit significant biological activity, making them of interest in pharmaceutical research or as intermediates in organic synthesis. The dinitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and solubility. Additionally, the compound's stability, melting point, and solubility in various solvents would depend on its specific structural features and the nature of its substituents. Safety and handling precautions are essential due to the potential toxicity associated with nitro compounds and halogenated derivatives.
Formula:C18H12ClFN4O4
InChI:InChI=1S/C18H12ClFN4O4/c19-11-5-7-12(8-6-11)21-14-3-1-2-4-15(14)22-16-9-13(20)17(23(25)26)10-18(16)24(27)28/h1-10,21-22H
InChI key:InChIKey=GGIYTWWXWDLVPX-UHFFFAOYSA-N
SMILES:N(C1=C(N(=O)=O)C=C(N(=O)=O)C(F)=C1)C2=C(NC3=CC=C(Cl)C=C3)C=CC=C2
Synonyms:
  • 1,2-Benzenediamine, N1-(4-chlorophenyl)-N2-(5-fluoro-2,4-dinitrophenyl)-
  • N1-(4-Chlorophenyl)-N2-(5-fluoro-2,4-dinitrophenyl)-1,2-benzenediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.