CymitQuimica logo

CAS 1332637-14-5

:

2-methoxy-3-(methoxycarbonyl)phenylboronic acid

Description:
2-Methoxy-3-(methoxycarbonyl)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a phenyl ring substituted with both methoxy and methoxycarbonyl groups, which contribute to its solubility and reactivity. The methoxycarbonyl group, a carboxylate derivative, enhances the compound's electrophilicity, facilitating reactions such as Suzuki coupling, a widely used method for forming carbon-carbon bonds. Additionally, the presence of the boronic acid moiety allows for potential applications in drug development and materials science, particularly in the design of sensors and catalysts. The compound's structural characteristics, including its molecular geometry and functional groups, play a crucial role in determining its chemical behavior and reactivity in various chemical environments. Overall, 2-methoxy-3-(methoxycarbonyl)phenylboronic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C9H11BO5
InChI:InChI=1S/C9H11BO5/c1-14-8-6(9(11)15-2)4-3-5-7(8)10(12)13/h3-5,12-13H,1-2H3
InChI key:YUUSYICBNQHHNZ-UHFFFAOYSA-N
SMILES:B(C1=C(C(=CC=C1)C(=O)OC)OC)(O)O
Synonyms:
  • 2-methoxy-3-(methoxycarbonyl)phenylboronic acid
Found 4 products.