CAS 133267-19-3
:ARTILIDE
Description:
ARTILIDE, with the CAS number 133267-19-3, is a chemical compound that belongs to the class of non-steroidal anti-inflammatory drugs (NSAIDs). It is primarily used for its analgesic and anti-inflammatory properties, making it beneficial in the treatment of conditions such as arthritis and other inflammatory disorders. The compound typically exhibits a mechanism of action that involves the inhibition of cyclooxygenase enzymes, which play a crucial role in the synthesis of prostaglandins—molecules that mediate inflammation and pain. ARTILIDE is characterized by its relatively low toxicity profile compared to other NSAIDs, although it may still present side effects such as gastrointestinal discomfort or allergic reactions in some individuals. Its pharmacokinetics, including absorption, distribution, metabolism, and excretion, are essential for determining its efficacy and safety in clinical use. As with any pharmaceutical agent, proper dosing and monitoring are critical to minimize adverse effects and maximize therapeutic benefits. Always consult relevant literature or a healthcare professional for specific information regarding its use and characteristics.
Formula:C19H34N2O3S
InChI:InChI=1/C19H34N2O3S/c1-4-6-14-21(15-7-5-2)16-8-9-19(22)17-10-12-18(13-11-17)20-25(3,23)24/h10-13,19-20,22H,4-9,14-16H2,1-3H3/t19-/m1/s1
SMILES:CCCCN(CCCC)CCC[C@H](c1ccc(cc1)NS(=O)(=O)C)O
Synonyms:- Artilide [INN]
- (R)-N-(4-(4-(Dibutylamino)-1-hydroxybutyl)phenyl)methanesulfonamide
- Unii-H5L34Mu3Tq
- Methanesulfonamide, N-(4-(4-(dibutylamino)-1-hydroxybutyl)phenyl)-, (R)-
- N-{4-[(1R)-4-(dibutylamino)-1-hydroxybutyl]phenyl}methanesulfonamide
- Artilide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
