CAS 13327-36-1

5-(Phenylmethylene)-2(5H)-furanone

Description:

5-(Phenylmethylene)-2(5H)-furanone, also known by its CAS number 13327-36-1, is an organic compound characterized by its furanone structure, which features a five-membered lactone ring containing both oxygen and carbon atoms. This compound typically exhibits a yellow to brown color and is known for its aromatic properties due to the presence of the phenylmethylene group. It is soluble in organic solvents, which makes it useful in various chemical applications, including as a potential flavoring agent or in the synthesis of other organic compounds. The furanone moiety contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions and cycloadditions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its stability and reactivity can be influenced by factors such as temperature and the presence of other functional groups in a reaction mixture. Overall, 5-(Phenylmethylene)-2(5H)-furanone is a versatile compound with potential applications in both industrial and research settings.

Formula: C₁₁H₈O₂

InChI: InChI=1S/C11H8O2/c12-11-7-6-10(13-11)8-9-4-2-1-3-5-9/h1-8H

InChI key: InChIKey=DMWDECPSZZVGPO-UHFFFAOYSA-N

SMILES: C(=C1C=CC(=O)O1)C2=CC=CC=C2

Synonyms:

• 2(5H)-Furanone, 5-benzylidene-
• 2,4-Pentadienoic acid, 4-hydroxy-5-phenyl-, γ-lactone
• 5-(Phenylmethylene)-2(5H)-furanone
• 2(5H)-Furanone, 5-(phenylmethylene)-

2(5H)-Furanone, 5-(phenylmethylene)-

CAS: 13327-36-1

Formula: C₁₁H₈O₂

Molecular weight: 172.18

Ref: IN-DA0014J1