CAS 1332765-67-9

Propanamide, N-(3S)-3-piperidinyl-, hydrochloride (1:1)

Description:

Propanamide, N-(3S)-3-piperidinyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group and a piperidine ring, which contributes to its biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various pharmaceutical applications. This compound typically exhibits properties such as moderate polarity due to the amide linkage and the piperidine nitrogen, which can participate in hydrogen bonding. Its stereochemistry, indicated by the (3S) designation, suggests specific spatial arrangements that may influence its interaction with biological targets, potentially affecting its pharmacological profile. As a hydrochloride salt, it is likely to be stable under standard conditions, with a melting point that may vary depending on the hydration state and purity. Overall, this compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications, although specific biological activities would require further investigation.

Formula: C₈H₁₆N₂O·ClH

InChI: InChI=1S/C8H16N2O.ClH/c1-2-8(11)10-7-4-3-5-9-6-7;/h7,9H,2-6H2,1H3,(H,10,11);1H/t7-;/m0./s1

InChI key: InChIKey=KROJSRLGGQJBPS-FJXQXJEOSA-N

SMILES: N(C(CC)=O)[C@H]1CCCNC1.Cl

Synonyms:

• Propanamide, N-(3S)-3-piperidinyl-, hydrochloride (1:1)

N-[(3S)-Piperidin-3-yl]propanamide hydrochloride

CAS: 1332765-67-9

N-[(3S)-Piperidin-3-yl]propanamide hydrochloride

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 192.69g/mol

Ref: 54-OR61264

(S)-N-(Piperidin-3-yl)propanamide hydrochloride

CAS: 1332765-67-9

Formula: C₈H₁₇ClN₂O

Molecular weight: 192.69

Ref: 10-F069519