CAS 1332765-72-6

Methanone, [(3R)-3-amino-1-pyrrolidinyl]-3-pyridinyl-, hydrochloride (1:2)

Description:

Methanone, [(3R)-3-amino-1-pyrrolidinyl]-3-pyridinyl-, hydrochloride (1:2), with CAS number 1332765-72-6, is a chemical compound characterized by its complex structure that includes a pyrrolidine ring and a pyridine moiety. This substance is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, particularly in pharmaceutical contexts. The presence of the amino group contributes to its potential biological activity, making it of interest in medicinal chemistry. The stereochemistry indicated by the (3R) designation suggests specific spatial arrangements of atoms, which can significantly influence the compound's interactions with biological targets. As a hydrochloride, it is likely to exhibit properties such as improved stability and bioavailability compared to its free base form. Overall, this compound's unique structural features and properties make it a subject of interest for further research, particularly in the development of therapeutic agents.

Formula: C₁₀H₁₃N₃O·2ClH

InChI: InChI=1S/C10H13N3O.2ClH/c11-9-3-5-13(7-9)10(14)8-2-1-4-12-6-8;;/h1-2,4,6,9H,3,5,7,11H2;2*1H/t9-;;/m1../s1

InChI key: InChIKey=DTWVYJHUIDJBBX-KLQYNRQASA-N

SMILES: C(=O)(N1C[C@H](N)CC1)C=2C=CC=NC2.Cl

Synonyms:

• Methanone, [(3R)-3-amino-1-pyrrolidinyl]-3-pyridinyl-, hydrochloride (1:2)

[(3R)-3-Aminopyrrolidin-1-yl](pyridin-3-yl)methanone dihydrochloride

CAS: 1332765-72-6

[(3R)-3-Aminopyrrolidin-1-yl](pyridin-3-yl)methanone dihydrochloride

Purity: ≥95%

Molecular weight: 264.15g/mol

Ref: 54-OR63019

(R)-1-[(Pyridin-3-yl)carbonyl]pyrrolidin-3-amine dihydrochloride

CAS: 1332765-72-6

Formula: C₁₀H₁₅Cl₂N₃O

Molecular weight: 264.15

Ref: 10-F069514