CymitQuimica logo

CAS 1332766-86-5

:

4-(Bromomethyl)-5-methyl-2-(4-methylphenyl)oxazole

Description:
4-(Bromomethyl)-5-methyl-2-(4-methylphenyl)oxazole is an organic compound characterized by its oxazole ring, which is a five-membered heterocyclic structure containing both nitrogen and oxygen. The presence of a bromomethyl group indicates that a bromine atom is attached to a methyl group, enhancing the compound's reactivity and potential for further chemical modifications. The methyl groups and the para-methylphenyl substituent contribute to the compound's hydrophobic characteristics, influencing its solubility and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for various applications in medicinal chemistry. Additionally, the presence of multiple functional groups suggests potential for diverse reactivity, including electrophilic substitution and nucleophilic attack. As with many brominated compounds, it is essential to consider environmental and safety aspects, particularly regarding its persistence and potential toxicity. Overall, 4-(Bromomethyl)-5-methyl-2-(4-methylphenyl)oxazole represents a complex structure with potential utility in synthetic organic chemistry and drug development.
Formula:C12H12BrNO
InChI:InChI=1S/C12H12BrNO/c1-8-3-5-10(6-4-8)12-14-11(7-13)9(2)15-12/h3-6H,7H2,1-2H3
InChI key:InChIKey=KRBHSLQGIXVZTN-UHFFFAOYSA-N
SMILES:C(Br)C=1N=C(OC1C)C2=CC=C(C)C=C2
Synonyms:
  • Oxazole, 4-(bromomethyl)-5-methyl-2-(4-methylphenyl)-
  • 4-(Bromomethyl)-5-methyl-2-(4-methylphenyl)oxazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.