CAS 133284-48-7

1-(4-Fluorophenyl)cyclopropanecarboxamide

Description:

1-(4-Fluorophenyl)cyclopropanecarboxamide, identified by its CAS number 133284-48-7, is a chemical compound characterized by its unique structural features. It consists of a cyclopropane ring attached to a carboxamide functional group and a para-fluorophenyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and interactions. The presence of the fluorine atom can enhance lipophilicity and potentially alter biological activity, making it of interest in medicinal chemistry. The cyclopropane moiety contributes to its strain and rigidity, which may affect conformational dynamics and binding interactions in biological systems. Additionally, the compound may exhibit specific solubility characteristics, depending on the solvent system used, and could participate in various chemical reactions, including nucleophilic substitutions and acylation processes. Overall, 1-(4-Fluorophenyl)cyclopropanecarboxamide is a compound of interest for research in organic synthesis and pharmacology, particularly in the development of new therapeutic agents.

Formula: C₁₀H₁₀FNO

InChI: InChI=1S/C10H10FNO/c11-8-3-1-7(2-4-8)10(5-6-10)9(12)13/h1-4H,5-6H2,(H2,12,13)

InChI key: InChIKey=VQEGVEJEUOVINR-UHFFFAOYSA-N

SMILES: C(N)(=O)C1(CC1)C2=CC=C(F)C=C2

Synonyms:

• 1-(4-Fluorophenyl)cyclopropane-1-carboxamide
• Cyclopropanecarboxamide, 1-(4-fluorophenyl)-
• 1-(4-Fluorophenyl)cyclopropanecarboxamide