CAS 1332873-11-6

5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-, methyl ester, hydrochloride (1:1)

Description:

5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its thiazole ring, which contributes to its heterocyclic nature. This compound features a carboxylic acid functional group and an aminoethyl side chain, indicating potential for biological activity, particularly in medicinal chemistry. The methyl ester form suggests that it may exhibit different solubility and reactivity compared to its acid counterpart. The hydrochloride salt form enhances its stability and solubility in aqueous environments, making it suitable for various applications, including pharmaceutical formulations. The presence of both acidic and basic functional groups allows for potential interactions with biological targets, which may be relevant in drug design. Additionally, the thiazole moiety is known for its role in various biological activities, including antimicrobial and anti-inflammatory properties. Overall, this compound's unique structural features and functional groups position it as a candidate for further research in medicinal chemistry and related fields.

Formula: C₇H₁₀N₂O₂S·ClH

InChI: InChI=1S/C7H10N2O2S.ClH/c1-4(8)6-9-3-5(12-6)7(10)11-2;/h3-4H,8H2,1-2H3;1H

InChI key: InChIKey=VEZPJLVSMYOEBW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1SC(C(C)N)=NC1.Cl

Synonyms:

• Methyl 2-(1-aminoethyl)thiazole-5-carboxylate hydrochloride
• 5-Thiazolecarboxylic acid, 2-(1-aminoethyl)-, methyl ester, hydrochloride (1:1)

Methyl 2-(1-aminoethyl)-1,3-thiazole-5-carboxylate hydrochloride

CAS: 1332873-11-6

Versatile small molecule scaffold

Formula: C₇H₁₁ClN₂O₂S

Purity: Min. 95%

Molecular weight: 222.69 g/mol

Ref: 3D-HDC87311