CymitQuimica logo

CAS 13329-14-1

:

1-Benzopyrylium, 2-phenyl-, chloride (1:1)

Description:
1-Benzopyrylium, 2-phenyl-, chloride (1:1), with the CAS number 13329-14-1, is a chemical compound characterized by its structure, which includes a benzopyrylium core and a phenyl substituent. This compound typically exhibits properties associated with aromaticity due to the presence of the benzene rings, contributing to its stability and reactivity. As a salt, it exists in a chloride form, indicating the presence of chloride ions that can influence its solubility and interaction with other substances. The compound may display interesting photophysical properties, making it relevant in various applications, including organic synthesis and materials science. Its reactivity can be attributed to the electrophilic nature of the benzopyrylium ion, which can participate in various chemical reactions, such as nucleophilic attacks. Additionally, the presence of the phenyl group can enhance its electronic properties, potentially affecting its behavior in different chemical environments. Overall, 1-Benzopyrylium, 2-phenyl-, chloride is a notable compound in the realm of organic chemistry with diverse implications in research and application.
Formula:C15H11O·Cl
InChI:InChI=1S/C15H11O.ClH/c1-2-6-12(7-3-1)15-11-10-13-8-4-5-9-14(13)16-15;/h1-11H;1H/q+1;/p-1
InChI key:InChIKey=GSGBDETVUFKCRJ-UHFFFAOYSA-M
SMILES:C1(=[O+]C2=C(C=C1)C=CC=C2)C3=CC=CC=C3.[Cl-]
Synonyms:
  • 1-Benzopyrylium, 2-phenyl-, chloride (1:1)
  • Flavinidin
  • 2-Phenyl-1-benzopyrylium chloride
  • Flavylium, chloride
  • 1-Benzopyrylium, 2-phenyl-, chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.