
CAS 13329-71-0
:Isopropyloctadecylamine
Description:
Isopropyloctadecylamine, with the CAS number 13329-71-0, is an organic compound characterized by its long hydrocarbon chain and amine functional group. It is a tertiary amine, which means it has three alkyl groups attached to the nitrogen atom, contributing to its hydrophobic properties. The presence of the isopropyl group enhances its solubility in organic solvents while the long octadecyl chain provides significant hydrophobic characteristics. This compound is typically used in various applications, including as a surfactant, emulsifier, or in the formulation of coatings and polymers. Its structure allows for interactions with both polar and non-polar substances, making it useful in modifying surface properties. Additionally, isopropyloctadecylamine may exhibit antimicrobial properties, which can be beneficial in certain industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C21H45N
InChI:InChI=1S/C21H45N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-21(2)3/h21-22H,4-20H2,1-3H3
InChI key:InChIKey=WHFZOMWNDCWQRF-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCC)CCCCCNC(C)C
Synonyms:- N-(1-Methylethyl)-1-octadecanamine
- 1-Octadecanamine, N-(1-methylethyl)-
- Isopropyloctadecylamine
- Octadecylamine, N-isopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
