
CAS 1332921-19-3
:3-(2-Fluorophenyl)-3-oxetanamine
Description:
3-(2-Fluorophenyl)-3-oxetanamine is a chemical compound characterized by its oxetane ring structure, which is a four-membered cyclic ether. The presence of a fluorophenyl group indicates that a fluorine atom is substituted on a phenyl ring, influencing the compound's electronic properties and potentially its reactivity. This compound may exhibit unique physical and chemical properties due to the combination of the oxetane moiety and the fluorinated aromatic system, which can affect its solubility, stability, and interaction with biological targets. The amine functional group suggests potential for hydrogen bonding and reactivity in various chemical reactions, making it of interest in medicinal chemistry and material science. Additionally, the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. Overall, 3-(2-Fluorophenyl)-3-oxetanamine represents a compound with potential applications in pharmaceuticals and research, warranting further investigation into its properties and uses.
Formula:C9H10FNO
InChI:InChI=1S/C9H10FNO/c10-8-4-2-1-3-7(8)9(11)5-12-6-9/h1-4H,5-6,11H2
InChI key:InChIKey=FWVYEOPTLQTOLQ-UHFFFAOYSA-N
SMILES:NC1(C2=C(F)C=CC=C2)COC1
Synonyms:- 3-Oxetanamine, 3-(2-fluorophenyl)-
- 3-(2-Fluorophenyl)-3-oxetanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.