CymitQuimica logo

CAS 133308-81-3

:

6-CHLORO-4-ETHYL-3-PHENYL-PYRIDAZINE

Description:
6-Chloro-4-ethyl-3-phenyl-pyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 6-position and an ethyl group at the 4-position, along with a phenyl group at the 3-position, contributes to its unique chemical properties and reactivity. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, influenced by the electron-withdrawing nature of the chlorine atom and the hydrophobic character of the phenyl and ethyl groups. The compound's solubility, stability, and reactivity can vary based on the functional groups attached to the pyridazine ring. As with many heterocycles, it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, depending on the reaction conditions. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.
Formula:C12H11ClN2
InChI:InChI=1S/C12H11ClN2/c1-2-9-8-11(13)14-15-12(9)10-6-4-3-5-7-10/h3-8H,2H2,1H3
InChI key:NFNKWOXAOFFVSN-UHFFFAOYSA-N
SMILES:CCC1=CC(=NN=C1C2=CC=CC=C2)Cl
Found 2 products.