CAS 13331-31-2
:benzyl hydrazinecarbodithioate
Description:
Benzyl hydrazinecarbodithioate, with the CAS number 13331-31-2, is a chemical compound characterized by the presence of a hydrazine functional group and dithioate moiety. It typically appears as a yellow to brown solid and is soluble in organic solvents. This compound is known for its potential applications in organic synthesis and as a reagent in various chemical reactions, particularly in the formation of thiosemicarbazones and related derivatives. The presence of the hydrazine group imparts reactivity, allowing it to participate in nucleophilic addition reactions. Additionally, the dithioate structure contributes to its ability to form coordination complexes with metal ions. Safety considerations are important when handling this compound, as it may pose health risks, including potential toxicity. Proper laboratory practices, including the use of personal protective equipment and adequate ventilation, are essential when working with benzyl hydrazinecarbodithioate. Overall, its unique structural features make it a compound of interest in both research and industrial applications.
Formula:C8H10N2S2
InChI:InChI=1/C8H10N2S2/c9-10-8(11)12-6-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,11)
SMILES:c1ccc(cc1)CSC(=NN)S
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
S-Benzyl Dithiocarbazate
CAS:Controlled ProductFormula:C8H10N2S2Color and Shape:NeatMolecular weight:198.308

