CAS 13331-93-6: 2,6-Dimethyl-4-nitrosophenol

Description:2,6-Dimethyl-4-nitrosophenol, with the CAS number 13331-93-6, is an organic compound characterized by the presence of a nitroso group (-NO) attached to a phenolic structure. This compound features two methyl groups at the 2 and 6 positions of the aromatic ring, which influence its chemical reactivity and solubility. It typically appears as a solid and is known for its potential applications in various fields, including analytical chemistry and as a reagent in organic synthesis. The nitroso group contributes to its reactivity, making it useful in the formation of azo compounds and other derivatives. Additionally, 2,6-Dimethyl-4-nitrosophenol may exhibit specific optical properties due to its molecular structure, which can be leveraged in colorimetric assays. However, like many nitroso compounds, it may pose health risks, necessitating careful handling and storage. Overall, its unique structural features and reactivity make it a compound of interest in both research and industrial applications.

Formula:C₈H₉NO₂

InChI:InChI=1S/C8H9NO2/c1-5-3-7(9-11)4-6(2)8(5)10/h3-4,10H,1-2H3

InChI key:InChIKey=JLGGFXVVFUIJBA-UHFFFAOYSA-N

SMILES:O=NC=1C=C(C(O)=C(C1)C)C

Synonyms:
2,6-Dimethyl-p-nitrosophenol
2,6-Xylenol, 4-nitroso-
4-Nitroso-2,6-xylenol
Ai3-19038
NSC 677516
Nsc 73813
Phenol, 2,6-dimethyl-4-nitroso-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Phenol, 2,6-dimethyl-4-nitroso- REF: IN-DA0014LNCAS: 13331-93-6	- - -	To inquire	Mon 10 Mar 25
2,6-Dimethyl-4-nitrosophenol REF: 54-OR8237CAS: 13331-93-6	- - -	To inquire	Tue 11 Mar 25
2,6-Dimethyl-4-nitrosophenol REF: 10-F747236CAS: 13331-93-6	95+%	To inquire	Thu 20 Mar 25
4-Nitroso-2,6-xylenol REF: 3D-FN07846CAS: 13331-93-6	Min. 95%	- - -	Discontinued product