CAS 133310-26-6: 9,10-difluoropalmitic acid

Description:9,10-Difluoropalmitic acid is a fluorinated fatty acid characterized by the presence of two fluorine atoms at the 9th and 10th carbon positions of the palmitic acid chain. This compound is a derivative of palmitic acid, a saturated fatty acid commonly found in animal and plant fats. The introduction of fluorine atoms alters the physical and chemical properties of the molecule, potentially enhancing its lipophilicity and stability. 9,10-Difluoropalmitic acid may exhibit unique biological activities due to its fluorinated structure, which can influence membrane fluidity and interactions with biological systems. It is typically a solid at room temperature, with a melting point influenced by the length of the carbon chain and the presence of fluorine. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a surfactant. As with many fluorinated compounds, it is essential to consider environmental and health impacts, as fluorinated substances can persist in the environment.

Formula:C₁₆H₃₀¹⁸F₂O₂

InChI:InChI=1/C16H30F2O2/c1-2-3-4-8-11-14(17)15(18)12-9-6-5-7-10-13-16(19)20/h14-15H,2-13H2,1H3,(H,19,20)/t14-,15+/m0/s1/i17-1,18-1