CymitQuimica logo

CAS 1333121-78-0

:

B-[4-[(Diethylamino)methyl]-3-fluorophenyl]boronic acid

Description:
B-[4-[(Diethylamino)methyl]-3-fluorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, including Suzuki coupling. The compound features a fluorinated aromatic ring, which can influence its electronic properties and reactivity. The diethylamino group enhances its solubility in organic solvents and may also affect its biological activity. This compound is typically utilized in medicinal chemistry and materials science, particularly in the development of pharmaceuticals and as a building block in organic synthesis. Its boronic acid functionality allows for potential applications in drug delivery systems and as a sensor for detecting specific biomolecules. Overall, the unique combination of functional groups in this compound contributes to its versatility in chemical applications.
Formula:C11H17BFNO2
InChI:InChI=1S/C11H17BFNO2/c1-3-14(4-2)8-9-5-6-10(12(15)16)7-11(9)13/h5-7,15-16H,3-4,8H2,1-2H3
InChI key:InChIKey=SCHRXPWOQATPOP-UHFFFAOYSA-N
SMILES:C(N(CC)CC)C1=C(F)C=C(B(O)O)C=C1
Synonyms:
  • B-[4-[(Diethylamino)methyl]-3-fluorophenyl]boronic acid
  • Boronic acid, B-[4-[(diethylamino)methyl]-3-fluorophenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.