CAS 1333222-16-4
:6-Methoxy-2,4-pyrimidinedimethanol
Description:
6-Methoxy-2,4-pyrimidinedimethanol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 2 and 4. The presence of a methoxy group at the 6-position contributes to its chemical reactivity and solubility properties. This compound features two hydroxymethyl (-CH2OH) groups, which enhance its potential for hydrogen bonding and increase its polarity. As a result, 6-Methoxy-2,4-pyrimidinedimethanol may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. Additionally, the presence of functional groups such as methoxy and hydroxymethyl may influence its interaction with other molecules, affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structural features position it as a valuable candidate for further research in various chemical and biological contexts.
Formula:C7H10N2O3
InChI:InChI=1S/C7H10N2O3/c1-12-7-2-5(3-10)8-6(4-11)9-7/h2,10-11H,3-4H2,1H3
InChI key:InChIKey=BDHPAXSEMROEHS-UHFFFAOYSA-N
SMILES:C(O)C=1C=C(OC)N=C(CO)N1
Synonyms:- 2,4-Pyrimidinedimethanol, 6-methoxy-
- 6-Methoxy-2,4-pyrimidinedimethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
