CymitQuimica logo

CAS 1333222-30-2

:

1,1-Dimethylethyl N-[4-bromo-3-[2-(trimethylsilyl)ethynyl]phenyl]carbamate

Description:
1,1-Dimethylethyl N-[4-bromo-3-[2-(trimethylsilyl)ethynyl]phenyl]carbamate, identified by its CAS number 1333222-30-2, is a chemical compound characterized by its complex structure, which includes a carbamate functional group and a brominated phenyl ring. The presence of the trimethylsilyl group indicates that it has potential applications in organic synthesis, particularly in reactions involving alkynes. This compound is likely to exhibit moderate to high lipophilicity due to the bulky dimethyl groups and the aromatic system, which can influence its solubility and reactivity. Additionally, the bromine substituent may enhance its electrophilic character, making it useful in various chemical transformations. The compound's stability and reactivity can be influenced by the steric hindrance provided by the dimethyl groups and the electronic effects of the bromine and silyl groups. Overall, this compound is of interest in medicinal chemistry and materials science, where its unique properties can be exploited for the development of new pharmaceuticals or functional materials.
Formula:C16H22BrNO2Si
InChI:InChI=1S/C16H22BrNO2Si/c1-16(2,3)20-15(19)18-13-7-8-14(17)12(11-13)9-10-21(4,5)6/h7-8,11H,1-6H3,(H,18,19)
InChI key:InChIKey=VKHXYUQWZVIDBV-UHFFFAOYSA-N
SMILES:C(#C[Si](C)(C)C)C1=CC(NC(OC(C)(C)C)=O)=CC=C1Br
Synonyms:
  • Carbamic acid, N-[4-bromo-3-[2-(trimethylsilyl)ethynyl]phenyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl N-[4-bromo-3-[2-(trimethylsilyl)ethynyl]phenyl]carbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.