
CAS 1333222-36-8
:2-Ethoxy-6-phenylpyrazine
Description:
2-Ethoxy-6-phenylpyrazine is an organic compound characterized by its pyrazine core, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an ethoxy group (-OCH2CH3) at the 2-position and a phenyl group (-C6H5) at the 6-position of the pyrazine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the ethoxy and phenyl substituents enhances its solubility in organic solvents and may impart specific reactivity patterns, making it of interest in various chemical applications, including synthesis and possibly in the flavor and fragrance industry. Additionally, the compound may exhibit biological activity, although specific studies would be necessary to elucidate its potential uses in pharmaceuticals or agrochemicals. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.
Formula:C12H12N2O
InChI:InChI=1S/C12H12N2O/c1-2-15-12-9-13-8-11(14-12)10-6-4-3-5-7-10/h3-9H,2H2,1H3
InChI key:InChIKey=ZBNHBGIRDDYRCK-UHFFFAOYSA-N
SMILES:O(CC)C=1N=C(C=NC1)C2=CC=CC=C2
Synonyms:- 2-Ethoxy-6-phenylpyrazine
- Pyrazine, 2-ethoxy-6-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
