
CAS 1333222-44-8
:2,3-Dibromoimidazo[1,2-a]pyridine
Description:
2,3-Dibromoimidazo[1,2-a]pyridine is a heterocyclic organic compound characterized by the presence of both imidazole and pyridine rings, which contribute to its unique chemical properties. The structure features two bromine atoms substituted at the 2 and 3 positions of the imidazole ring, enhancing its reactivity and potential for various chemical transformations. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular framework allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with imidazole derivatives. Additionally, the presence of bromine atoms can facilitate further functionalization, making it a versatile intermediate in synthetic organic chemistry. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 2,3-Dibromoimidazo[1,2-a]pyridine represents an interesting compound for research and development in various chemical fields.
Formula:C7H4Br2N2
InChI:InChI=1S/C7H4Br2N2/c8-6-7(9)11-4-2-1-3-5(11)10-6/h1-4H
InChI key:InChIKey=DNLKCKCNHPVECZ-UHFFFAOYSA-N
SMILES:BrC=1N2C(=NC1Br)C=CC=C2
Synonyms:- 2,3-Dibromoimidazo[1,2-a]pyridine
- Imidazo[1,2-a]pyridine, 2,3-dibromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
