CAS 1333222-45-9
:3-Fluoro-2-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Fluoro-2-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a complex organic compound characterized by its pyridine core, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 3-position and a phenylmethoxy group at the 2-position contributes to its unique reactivity and potential applications in medicinal chemistry and material science. The 4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl moiety introduces boron into the structure, which can enhance its utility in cross-coupling reactions and as a potential building block in organic synthesis. This compound may exhibit interesting electronic properties due to the combination of electron-withdrawing and electron-donating groups, influencing its behavior in various chemical environments. Additionally, its structural complexity suggests potential applications in drug development or as a ligand in coordination chemistry. Overall, the unique combination of functional groups and structural features makes this compound a subject of interest for further research and application in various fields of chemistry.
Formula:C18H21BFNO3
InChI:InChI=1S/C18H21BFNO3/c1-17(2)18(3,4)24-19(23-17)14-10-15(20)16(21-11-14)22-12-13-8-6-5-7-9-13/h5-11H,12H2,1-4H3
InChI key:InChIKey=NPCDRYABULDPRH-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(F)C(OCC3=CC=CC=C3)=NC2
Synonyms:- 3-Fluoro-2-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
- Pyridine, 3-fluoro-2-(phenylmethoxy)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Benzyloxy)-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C18H21BFNO3Molecular weight:329.1736
