CAS 13333-49-8
:4-(Methylthio)-2-nitrophenol
Description:
4-(Methylthio)-2-nitrophenol, with the CAS number 13333-49-8, is an organic compound characterized by the presence of a nitro group and a methylthio group attached to a phenolic structure. This compound typically appears as a solid and is known for its yellow to brown coloration, which is indicative of the nitro group. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic methylthio group. The presence of both the nitro and methylthio groups contributes to its chemical reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, this compound may exhibit biological activity, which can be of interest in fields such as medicinal chemistry and agrochemicals. Safety data should be consulted, as compounds with nitro groups can sometimes be hazardous, and appropriate handling procedures should be followed to mitigate any risks associated with exposure.
Formula:C7H7NO3S
InChI:InChI=1S/C7H7NO3S/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3
InChI key:InChIKey=QOVVFTWHKWXRII-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(SC)=CC=C1O
Synonyms:- Phenol, 4-(methylthio)-2-nitro-
- 4-(Methylthio)-2-nitrophenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
