
CAS 13333-91-0
:3,6-Dimethyl-9H-xanthene
Description:
3,6-Dimethyl-9H-xanthene is an organic compound belonging to the xanthene family, characterized by its polycyclic aromatic structure. This compound features two methyl groups attached to the xanthene backbone, specifically at the 3 and 6 positions, which can influence its chemical reactivity and physical properties. Typically, xanthene derivatives exhibit fluorescence, making them of interest in various applications, including dyes and fluorescent probes. The presence of methyl groups can enhance solubility in organic solvents and may affect the compound's stability and interaction with other molecules. 3,6-Dimethyl-9H-xanthene is generally stable under standard conditions but may undergo reactions typical of aromatic compounds, such as electrophilic substitution. Its CAS number, 13333-91-0, allows for easy identification in chemical databases. Overall, this compound's unique structure and properties make it a subject of interest in organic chemistry and materials science.
Formula:C15H14O
InChI:InChI=1S/C15H14O/c1-10-3-5-12-9-13-6-4-11(2)8-15(13)16-14(12)7-10/h3-8H,9H2,1-2H3
InChI key:InChIKey=ZMMDXPSNHBJVFL-UHFFFAOYSA-N
SMILES:CC=1C=C2C(CC=3C(O2)=CC(C)=CC3)=CC1
Synonyms:- Xanthene, 3,6-dimethyl-
- 3,6-Dimethyl-9H-xanthene
- 9H-Xanthene, 3,6-dimethyl-
- 3,6-Dimethylxanthene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
