CymitQuimica logo

CAS 133330-59-3

:

8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-β]pyridin-11-one 1-Oxide

Description:
8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-β]pyridin-11-one 1-oxide, with CAS number 133330-59-3, is a chemical compound characterized by its complex bicyclic structure, which includes a chlorinated benzene ring fused to a pyridine moiety. This compound features a nitrogen atom within its heterocyclic framework, contributing to its potential biological activity. The presence of the 1-oxide functional group indicates that it has an oxygen atom bonded to the nitrogen, which can influence its reactivity and stability. The chlorination at the 8-position may enhance its lipophilicity and alter its interaction with biological targets. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The unique structural features of this compound may also impart specific electronic properties, making it of interest in various chemical and biological research fields. As with many heterocycles, its synthesis and characterization are crucial for understanding its reactivity and potential applications.
Formula:C14H10ClNO2
InChI:InChI=1/C14H10ClNO2/c15-11-5-6-12-10(8-11)4-3-9-2-1-7-16(18)13(9)14(12)17/h1-2,5-8H,3-4H2
SMILES:c1cc2CCc3cc(ccc3C(=O)c2n(=O)c1)Cl
Synonyms:
  • 8-Chloro-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-β]pyridin-11-one N1-Oxide
  • 8-Chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one 1-Oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.