CymitQuimica logo

CAS 133330-61-7

:

2,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one

Description:
2,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a benzo and a pyridine moiety. The presence of two chlorine atoms at the 2 and 8 positions contributes to its reactivity and potential biological activity. This compound features a ketone functional group, which can influence its chemical behavior, including its ability to participate in various reactions such as nucleophilic attacks. The dihydro configuration indicates that it contains saturated carbon atoms, which may affect its stability and solubility in different solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms and the unique arrangement of rings. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the presence of functional groups, making it a subject of interest for further research in organic synthesis and drug design.
Formula:C14H9Cl2NO
InChI:InChI=1S/C14H9Cl2NO/c15-10-4-5-11-9(7-10)2-1-8-3-6-12(16)17-13(8)14(11)18/h3-7H,1-2H2
InChI key:InChIKey=HGCFDJOSJCJZAR-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(Cl)=CC2)CCC=3C1=NC(Cl)=CC3
Synonyms:
  • 11H-Benzo[5,6]cyclohepta[1,2-b]pyridin-11-one, 2,8-dichloro-5,6-dihydro-
  • 2,8-Dichloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.