CAS 133331-77-8
:Perfluorohexyloctane
Description:
Perfluorohexyloctane, with the CAS number 133331-77-8, is a perfluorinated compound characterized by a long carbon chain structure where all hydrogen atoms are replaced by fluorine atoms. This results in a highly hydrophobic and lipophobic substance, making it resistant to water and oil. The compound exhibits exceptional thermal and chemical stability, which is a hallmark of perfluorinated compounds, allowing it to withstand extreme conditions without degrading. Its unique properties include low surface tension and high surface activity, making it useful in various applications, such as surfactants, lubricants, and in the formulation of water-repellent coatings. Additionally, perfluorohexyloctane is non-biodegradable and can persist in the environment, raising concerns regarding its ecological impact and potential bioaccumulation. As with many perfluorinated substances, it is important to handle it with care due to its potential health effects and environmental persistence. Overall, perfluorohexyloctane exemplifies the characteristics of perfluorinated compounds, combining stability with unique surface properties.
Formula:C14H17F13
InChI:InChI=1S/C14H17F13/c1-2-3-4-5-6-7-8-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h2-8H2,1H3
InChI key:InChIKey=WRYIIOKOQSICTB-UHFFFAOYSA-N
SMILES:C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(CCCCCCCC)(F)F)(F)F)(F)F
Synonyms:- Perfluorohexyloctane
- 1-n-perfluorohexyloctane
- Tetradecane, 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-
- F 6H8
- 8-(Perfluorohexyl)octane
- 1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluorotetradecane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Tetradecane, 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoro-
CAS:Formula:C14H17F13Purity:97%Color and Shape:LiquidMolecular weight:432.26401-(Perfluorohexyl)octane
CAS:1-(Perfluorohexyl)octaneFormula:C14H17F13Purity:97%Color and Shape: clear. colourless liquidMolecular weight:432.26402g/mol1,1,1,2,2,3,3,4,4,5,5,6,6-Tridecafluoro-Tetradecane
CAS:Tridecafluoro-tetradecane is a fluorinated hydrocarbon that is used to produce silicone. It is a non-flammable, colorless liquid with an odorless odor. Tridecafluoro-tetradecane causes retinal degeneration in vivo and histological changes in human corneal endothelial cells in vitro. It also has the ability to induce proinflammatory cytokines and chemokines in human macrophages. The effects of tridecafluoro-tetradecane on the retina have been studied using fluorescein angiography and pharmacokinetic analysis. These studies suggest that tridecafluoro-tetradecane may be an effective treatment for retinal diseases such as proliferative diabetic retinopathy (PDR).Formula:C14H17F13Purity:Min. 95%Molecular weight:432.26 g/mol



