
CAS 133331-79-0
:4-Amino-3-hydroxybenzeneacetic acid
Description:
4-Amino-3-hydroxybenzeneacetic acid, also known as para-aminosalicylic acid (PAS), is an aromatic compound characterized by the presence of both amino and hydroxyl functional groups attached to a benzene ring, along with an acetic acid moiety. This compound typically appears as a white to off-white crystalline powder and is soluble in water, reflecting its polar nature due to the functional groups. It exhibits properties such as being a weak acid, with the ability to form salts and esters. The amino group contributes to its basicity, while the hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar solvents. 4-Amino-3-hydroxybenzeneacetic acid is primarily recognized for its pharmaceutical applications, particularly in the treatment of tuberculosis, where it acts as an antitubercular agent. Its mechanism of action involves inhibiting the synthesis of folic acid in bacteria, thereby impeding their growth. Additionally, it may have antioxidant properties, making it of interest in various biochemical research contexts.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,10H,4,9H2,(H,11,12)
InChI key:InChIKey=PZBRNLKXQFPHIP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC(O)=C(N)C=C1
Synonyms:- Benzeneacetic acid, 4-amino-3-hydroxy-
- 4-Amino-3-hydroxybenzeneacetic acid
- 3-Hydroxy-4-aminophenylacetic acid
- 2-(4-Amino-3-hydroxyphenyl)acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
