CAS 1333319-49-5
:2-Ethoxy-6-[6-(phenylmethoxy)-3-pyridinyl]pyrazine
Description:
2-Ethoxy-6-[6-(phenylmethoxy)-3-pyridinyl]pyrazine is a chemical compound characterized by its complex structure, which includes a pyrazine ring fused with a pyridine moiety and an ethoxy group. This compound features multiple functional groups, including an ether linkage from the phenylmethoxy group, which contributes to its solubility and reactivity. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors or enzymes. The compound's molecular architecture suggests it may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its CAS number, 1333319-49-5, allows for precise identification in chemical databases. As with many organic compounds, its stability, reactivity, and potential applications would depend on specific conditions such as pH, temperature, and the presence of other chemical species. Further studies would be necessary to elucidate its full range of characteristics and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C18H17N3O2
InChI:InChI=1S/C18H17N3O2/c1-2-22-18-12-19-11-16(21-18)15-8-9-17(20-10-15)23-13-14-6-4-3-5-7-14/h3-12H,2,13H2,1H3
InChI key:InChIKey=IUAJKMDUJVPYSL-UHFFFAOYSA-N
SMILES:O(CC)C=1N=C(C=NC1)C=2C=CC(OCC3=CC=CC=C3)=NC2
Synonyms:- 2-Ethoxy-6-[6-(phenylmethoxy)-3-pyridinyl]pyrazine
- Pyrazine, 2-ethoxy-6-[6-(phenylmethoxy)-3-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
