CymitQuimica logo

CAS 1333319-51-9

:

3-Cyano-N-(1,1-dimethylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide

Description:
3-Cyano-N-(1,1-dimethylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide is a chemical compound characterized by its complex structure, which includes a cyano group, a benzamide moiety, and a boron-containing dioxaborolane. The presence of the cyano group indicates potential reactivity and polarity, while the benzamide structure contributes to its stability and solubility in organic solvents. The tert-butyl group (1,1-dimethylethyl) enhances the compound's steric hindrance, potentially influencing its reactivity and interactions with other molecules. The dioxaborolane unit is notable for its ability to participate in various chemical reactions, including those involving boron chemistry, which is significant in organic synthesis and materials science. This compound may exhibit interesting properties such as fluorescence or catalytic activity, depending on its specific application. Overall, its unique combination of functional groups suggests potential utility in pharmaceuticals, agrochemicals, or advanced materials. However, detailed studies would be necessary to fully elucidate its properties and applications.
Formula:C18H25BN2O3
InChI:InChI=1S/C18H25BN2O3/c1-16(2,3)21-15(22)13-8-12(11-20)9-14(10-13)19-23-17(4,5)18(6,7)24-19/h8-10H,1-7H3,(H,21,22)
InChI key:InChIKey=NIOAAWIYVNEMED-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(C(NC(C)(C)C)=O)=CC(C#N)=C2
Synonyms:
  • Benzamide, 3-cyano-N-(1,1-dimethylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
  • 3-Cyano-N-(1,1-dimethylethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.