CymitQuimica logo

CAS 1333319-54-2

:

3-[2,4-Bis(trifluoromethyl)phenyl]-5-methoxypyridine

Description:
3-[2,4-Bis(trifluoromethyl)phenyl]-5-methoxypyridine, identified by its CAS number 1333319-54-2, is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with a methoxy group and a phenyl group that carries two trifluoromethyl groups. This compound exhibits notable lipophilicity due to the presence of the trifluoromethyl groups, which can enhance its biological activity and influence its interactions with various biological targets. The methoxy group contributes to its solubility properties and can affect its reactivity. The presence of multiple electronegative fluorine atoms typically imparts unique electronic characteristics, making it a subject of interest in medicinal chemistry and material science. Additionally, the compound's structural features may confer specific pharmacological properties, potentially making it useful in the development of pharmaceuticals or agrochemicals. Overall, its unique combination of functional groups and structural attributes positions it as a valuable compound for further research and application in various chemical fields.
Formula:C14H9F6NO
InChI:InChI=1S/C14H9F6NO/c1-22-10-4-8(6-21-7-10)11-3-2-9(13(15,16)17)5-12(11)14(18,19)20/h2-7H,1H3
InChI key:InChIKey=RCUWOAVLFJJUDV-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(C=CC(C(F)(F)F)=C1)C=2C=C(OC)C=NC2
Synonyms:
  • Pyridine, 3-[2,4-bis(trifluoromethyl)phenyl]-5-methoxy-
  • 3-[2,4-Bis(trifluoromethyl)phenyl]-5-methoxypyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.