CymitQuimica logo

CAS 1333319-64-4

:

5-Bromo-N-(2,2-dimethylpropyl)-3-pyridinemethanamine

Description:
5-Bromo-N-(2,2-dimethylpropyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a bromine atom and a pyridine ring. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications. The 2,2-dimethylpropyl group contributes to the compound's steric bulk, potentially influencing its interaction with biological targets or other chemical species. This compound is likely to exhibit basic properties due to the amine functional group, which can participate in protonation reactions. Its pyridine moiety may also contribute to aromatic stability and influence solubility in organic solvents. The compound's specific applications can vary, but it may be relevant in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Safety and handling considerations are essential, as with any brominated compound, due to potential toxicity and environmental impact. Overall, 5-Bromo-N-(2,2-dimethylpropyl)-3-pyridinemethanamine represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C11H17BrN2
InChI:InChI=1S/C11H17BrN2/c1-11(2,3)8-14-6-9-4-10(12)7-13-5-9/h4-5,7,14H,6,8H2,1-3H3
InChI key:InChIKey=QKBNANJCUKYMLN-UHFFFAOYSA-N
SMILES:C(NCC(C)(C)C)C=1C=C(Br)C=NC1
Synonyms:
  • 3-Pyridinemethanamine, 5-bromo-N-(2,2-dimethylpropyl)-
  • 5-Bromo-N-(2,2-dimethylpropyl)-3-pyridinemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.