CAS 1333319-65-5
:N,N-Bis(1-methylethyl)ethenesulfonamide
Description:
N,N-Bis(1-methylethyl)ethenesulfonamide, identified by its CAS number 1333319-65-5, is a sulfonamide compound characterized by the presence of two isopropyl groups attached to a sulfonamide functional group. This compound features a sulfonyl group (–SO2) linked to an amine, which contributes to its chemical reactivity and potential applications. Typically, sulfonamides exhibit properties such as good solubility in polar solvents and moderate stability under various conditions. The presence of the ethene moiety suggests potential for polymerization or other reactions involving double bonds. In terms of applications, compounds of this nature may be explored in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific characteristics, such as melting point, boiling point, and reactivity, would depend on the molecular structure and the surrounding environment. As with many sulfonamides, it is essential to consider safety and handling protocols due to potential biological activity and environmental impact.
Formula:C8H17NO2S
InChI:InChI=1S/C8H17NO2S/c1-6-12(10,11)9(7(2)3)8(4)5/h6-8H,1H2,2-5H3
InChI key:InChIKey=JVMGMEUIBRDQAJ-UHFFFAOYSA-N
SMILES:N(S(C=C)(=O)=O)(C(C)C)C(C)C
Synonyms:- N,N-Bis(1-methylethyl)ethenesulfonamide
- Ethenesulfonamide, N,N-bis(1-methylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.