
CAS 1333319-69-9
:4-Iodo-2-(phenylmethoxy)pyrimidine
Description:
4-Iodo-2-(phenylmethoxy)pyrimidine is a chemical compound characterized by its pyrimidine ring, which is a six-membered heterocyclic structure containing two nitrogen atoms at positions 1 and 3. The presence of an iodine atom at the 4-position enhances its reactivity and can influence its biological activity. The phenylmethoxy group at the 2-position contributes to the compound's lipophilicity, potentially affecting its solubility and interaction with biological membranes. This compound may exhibit properties typical of pyrimidine derivatives, such as involvement in nucleic acid metabolism or as a scaffold for drug development. Its unique structure suggests potential applications in medicinal chemistry, particularly in the design of pharmaceuticals targeting specific biological pathways. Additionally, the presence of the iodine atom may facilitate certain types of chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Overall, 4-Iodo-2-(phenylmethoxy)pyrimidine represents a versatile compound with potential implications in various fields, including drug discovery and materials science.
Formula:C11H9IN2O
InChI:InChI=1S/C11H9IN2O/c12-10-6-7-13-11(14-10)15-8-9-4-2-1-3-5-9/h1-7H,8H2
InChI key:InChIKey=ZOHLJHPNLAHFOE-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C=2N=C(I)C=CN2
Synonyms:- Pyrimidine, 4-iodo-2-(phenylmethoxy)-
- 2-Benzyloxy-4-iodopyrimidine
- 4-Iodo-2-(phenylmethoxy)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
