CAS 1333319-77-9
:3-(Diethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-(Diethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a dioxaborolane moiety. The presence of the diethoxymethyl group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The dioxaborolane group is known for its ability to participate in boron-mediated reactions, such as Suzuki coupling, which is valuable in the formation of carbon-carbon bonds. This compound may exhibit properties such as moderate stability under ambient conditions, but it is sensitive to moisture due to the presence of the boron atom. Additionally, the compound's functional groups suggest potential reactivity, allowing it to serve as a versatile intermediate in the synthesis of more complex molecules. Overall, its structural characteristics and functional groups make it a compound of interest in the fields of organic chemistry and materials science.
Formula:C16H26BNO4
InChI:InChI=1S/C16H26BNO4/c1-7-19-14(20-8-2)12-9-13(11-18-10-12)17-21-15(3,4)16(5,6)22-17/h9-11,14H,7-8H2,1-6H3
InChI key:InChIKey=IAPJTCZYMZFFIR-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=C(C(OCC)OCC)C=NC2
Synonyms:- Pyridine, 3-(diethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-(Diethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(Diethoxymethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C16H26BNO4Molecular weight:307.1929
