CAS 1333319-78-0

1-[6-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone

Description:

1-[6-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone is a chemical compound characterized by its complex structure, which includes an indazole moiety, a fluorine atom, and a boron-containing dioxaborolane group. The presence of the fluorine atom typically enhances the compound's biological activity and lipophilicity, making it potentially useful in medicinal chemistry. The dioxaborolane group is known for its stability and ability to participate in various chemical reactions, including Suzuki coupling, which is significant in organic synthesis. This compound may exhibit specific reactivity patterns due to the electron-withdrawing nature of the fluorine and the steric effects from the bulky tetramethyl groups. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of targeted therapies. As with many synthetic organic compounds, its solubility, stability, and reactivity would be influenced by the functional groups present, making it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₅H₁₈BFN₂O₃

InChI: InChI=1S/C15H18BFN2O3/c1-9(20)19-13-7-10(17)6-12(11(13)8-18-19)16-21-14(2,3)15(4,5)22-16/h6-8H,1-5H3

InChI key: InChIKey=HXLZYOWKAQSUKL-UHFFFAOYSA-N

SMILES: C(C)(=O)N1C=2C(=C(C=C(F)C2)B3OC(C)(C)C(C)(C)O3)C=N1

Synonyms:

• Ethanone, 1-[6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]-
• 1-[6-Fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]ethanone

Ethanone, 1-[6-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazol-1-yl]-

CAS: 1333319-78-0

Formula: C₁₅H₁₈BFN₂O₃

Purity: 97%

Molecular weight: 304.1244

Ref: IN-DA0014OU