CymitQuimica logo

CAS 133332-53-3

:

2-Amino-α-ethylbenzenemethanamine

Description:
2-Amino-α-ethylbenzenemethanamine, also known as a substituted phenethylamine, is a chemical compound characterized by the presence of an amino group and an ethyl group attached to a benzene ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. It may also display moderate volatility and reactivity due to the presence of the amino group, making it a potential candidate for various chemical reactions, including alkylation and acylation. The structure suggests that it could interact with biological systems, potentially exhibiting pharmacological activity. However, specific safety and handling guidelines should be followed, as with all amines, due to possible toxicity and irritant properties. As with any chemical, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including temperature, pH, and the presence of other reactive species.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-2-8(10)7-5-3-4-6-9(7)11/h3-6,8H,2,10-11H2,1H3
InChI key:InChIKey=UUZCNFWPRJSBHJ-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=C(N)C=CC=C1
Synonyms:
  • 2-Amino-α-ethylbenzenemethanamine
  • 2-(1-Aminopropyl)aniline
  • α-(2-Aminophenyl)propylamine
  • Benzenemethanamine, 2-amino-α-ethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.