
CAS 133332-54-4
:4-Amino-α-ethylbenzenemethanamine
Description:
4-Amino-α-ethylbenzenemethanamine, also known by its CAS number 133332-54-4, is an organic compound characterized by the presence of an amino group (-NH2) and an ethyl group attached to a benzene ring. This compound features a primary amine structure, which contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the ethyl group enhances its hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the amino group can participate in hydrogen bonding, affecting its physical properties such as boiling and melting points. This compound may be utilized in the synthesis of pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, 4-Amino-α-ethylbenzenemethanamine is a versatile compound with potential applications in both research and industry.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-2-9(11)7-3-5-8(10)6-4-7/h3-6,9H,2,10-11H2,1H3
InChI key:InChIKey=IYWMAXHBPYOXNJ-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=CC=C(N)C=C1
Synonyms:- Benzenemethanamine, 4-amino-α-ethyl-
- 4-Amino-α-ethylbenzenemethanamine
- α-(4-Aminophenyl)propylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
