CAS 133336-92-2

N-(4-Methylphenyl)-N′-[4-[[4-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]methyl]phenyl]urea

Description:

N-(4-Methylphenyl)-N′-[4-[[4-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]methyl]phenyl]urea, with CAS number 133336-92-2, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple aromatic rings and functional groups such as urea and amine moieties. This compound typically exhibits properties associated with organic ureas, including potential solubility in organic solvents and moderate stability under standard conditions. Its structure suggests it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the aromatic amine groups that can participate in various chemical interactions. Additionally, the presence of methyl groups may influence its lipophilicity and biological activity. As with many organic compounds, its reactivity can be influenced by environmental factors such as pH and temperature. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₂₉H₂₈N₄O₂

InChI: InChI=1S/C29H28N4O2/c1-20-3-11-24(12-4-20)30-28(34)32-26-15-7-22(8-16-26)19-23-9-17-27(18-10-23)33-29(35)31-25-13-5-21(2)6-14-25/h3-18H,19H2,1-2H3,(H2,30,32,34)(H2,31,33,35)

InChI key: InChIKey=MVFNQVJAYJPMFQ-UHFFFAOYSA-N

SMILES: C(C1=CC=C(NC(NC2=CC=C(C)C=C2)=O)C=C1)C3=CC=C(NC(NC4=CC=C(C)C=C4)=O)C=C3

Synonyms:

• Urea, N-(4-methylphenyl)-N′-[4-[[4-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]methyl]phenyl]-
• Urea, N,N′′-(methylenedi-4,1-phenylene)bis[N′-(4-methylphenyl)-
• N-(4-Methylphenyl)-N′-[4-[[4-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]methyl]phenyl]urea

Urea, N-(4-methylphenyl)-N'-[4-[[4-[[[(4-methylphenyl)amino]carbonyl]amino]phenyl]methyl]phenyl]-

CAS: 133336-92-2

Formula: C₂₉H₂₈N₄O₂

Molecular weight: 464.5582

Ref: IN-DA0014P3