CAS 1333377-78-8
:2,5-Dioxo-1-pyrrolidinyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]acetate
Description:
2,5-Dioxo-1-pyrrolidinyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]acetate, identified by its CAS number 1333377-78-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrolidine ring and an isoindole moiety. This compound typically exhibits properties associated with both its functional groups, such as potential reactivity due to the presence of carbonyl groups and the ability to participate in various chemical reactions, including nucleophilic attacks. It may also display biological activity, making it of interest in pharmaceutical research. The presence of dioxo and ether functionalities suggests that it could engage in hydrogen bonding and other intermolecular interactions, influencing its solubility and stability in different solvents. Additionally, the compound's unique structure may confer specific pharmacological properties, warranting further investigation into its potential applications in drug development or as a biochemical tool. As with many synthetic compounds, safety and handling precautions should be observed due to the potential for toxicity or reactivity.
Formula:C14H10N2O7
InChI:InChI=1S/C14H10N2O7/c17-10-5-6-11(18)15(10)23-12(19)7-22-16-13(20)8-3-1-2-4-9(8)14(16)21/h1-4H,5-7H2
InChI key:InChIKey=ILKISXMROPLMCR-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1OCC(ON3C(=O)CCC3=O)=O)=CC=CC2
Synonyms:- Acetic acid, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]-, 2,5-dioxo-1-pyrrolidinyl ester
- 2,5-Dioxo-1-pyrrolidinyl 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy]acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.