CAS 13334-00-4
:(2-TRIFLUOROMETHYL-PHENYLTHIO)-ACETIC ACID
Description:
(2-Trifluoromethyl-phenylthio)-acetic acid, with the CAS number 13334-00-4, is an organic compound characterized by the presence of a trifluoromethyl group and a phenylthio moiety attached to an acetic acid backbone. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it a versatile intermediate in organic synthesis. The trifluoromethyl group contributes to its lipophilicity and can enhance biological activity, while the phenylthio group may influence its reactivity and solubility in various solvents. The presence of the carboxylic acid functional group allows for potential hydrogen bonding and reactivity in esterification or amidation reactions. Additionally, the compound may exhibit unique electronic properties due to the electron-withdrawing nature of the trifluoromethyl group, which can affect its behavior in chemical reactions and interactions with biological systems. Overall, (2-trifluoromethyl-phenylthio)-acetic acid is of interest in pharmaceutical and agrochemical research due to its potential applications in drug development and synthesis.
Formula:C8H5F3OS
InChI:InChI=1/C8H5F3OS/c9-8(10,11)7(13)12-6-4-2-1-3-5-6/h1-5H
SMILES:c1ccc(cc1)OC(=S)C(F)(F)F
Synonyms:- 2-(Trifluoromethyl)phenylthioaceticacid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
