CAS 133341-88-5

4-[(Methylamino)carbonyl]-1H-pyrrole-3-carboxylic acid

Description:

4-[(Methylamino)carbonyl]-1H-pyrrole-3-carboxylic acid, with the CAS number 133341-88-5, is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a carboxylic acid functional group and a methylamino group, contributing to its potential as a bioactive molecule. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The methylamino substituent can influence its reactivity and interaction with biological systems, making it of interest in medicinal chemistry. The compound may participate in various chemical reactions, including acylation and amination, and could serve as a building block for more complex molecules. Its properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods. Overall, this compound's unique structure and functional groups suggest potential applications in pharmaceuticals or agrochemicals, warranting further investigation into its biological activity and chemical behavior.

Formula: C₇H₈N₂O₃

InChI: InChI=1S/C7H8N2O3/c1-8-6(10)4-2-9-3-5(4)7(11)12/h2-3,9H,1H3,(H,8,10)(H,11,12)

InChI key: InChIKey=DULCTIYRHONOFG-UHFFFAOYSA-N

SMILES: C(NC)(=O)C=1C(C(O)=O)=CNC1

Synonyms:

• 1H-Pyrrole-3-carboxylic acid, 4-[(methylamino)carbonyl]-
• 4-[(Methylamino)carbonyl]-1H-pyrrole-3-carboxylic acid