CAS 133342-48-0
:N-CYCLOHEXYLPROPYL DEOXYNOJIRIMYCIN
Description:
N-Cyclohexylpropyl deoxynojirimycin is a chemical compound that belongs to the class of iminosugars, which are structurally similar to sugars but contain a nitrogen atom in place of an oxygen atom. This compound is known for its potential therapeutic applications, particularly in the treatment of viral infections and certain metabolic disorders. It acts as an inhibitor of glycosidases, enzymes that play a crucial role in carbohydrate metabolism. The presence of the cyclohexyl and propyl groups in its structure contributes to its lipophilicity, which may influence its bioavailability and interaction with biological membranes. N-Cyclohexylpropyl deoxynojirimycin has been studied for its effects on glycoprotein processing and its potential to modulate immune responses. As with many iminosugars, its pharmacological profile is of interest in medicinal chemistry, particularly for developing antiviral agents and treatments for conditions like diabetes. However, detailed studies on its safety, efficacy, and mechanism of action are essential for understanding its full potential in clinical applications.
Formula:C15H29NO4
InChI:InChI=1/C15H29NO4/c17-10-12-14(19)15(20)13(18)9-16(12)8-4-7-11-5-2-1-3-6-11/h11-15,17-20H,1-10H2/t12-,13+,14-,15-/m1/s1
Synonyms:- Sp173
- (2R,3R,4R,5S)-1-(3-cyclohexylpropyl)-2-(hydroxymethyl)piperidine-3,4,5-triol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-Cyclohexylpropyl Deoxynojirimycin
CAS:Formula:C15H29NO4Color and Shape:SolidMolecular weight:287.3951N-Cyclohexylpropyl deoxynorjirimycin
CAS:N-Cyclohexylpropyl deoxynorjirimycin is a sugar that belongs to the group of carbohydrates. It is an analog of deoxynojirimycin and has been synthesized by glycosylation, methylation, and fluorination of the natural product. N-Cyclohexylpropyl deoxynorjirimycin can be used as an intermediate for the synthesis of other carbohydrate compounds.Formula:C15H29NO4Purity:Min. 95%Molecular weight:287.4 g/mol

