CymitQuimica logo

CAS 1333491-21-6

:

4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-aminoethyl)-6,7,8,9-tetrahydro-2-methyl-, hydrochloride (1:2)

Description:
4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-aminoethyl)-6,7,8,9-tetrahydro-2-methyl-, hydrochloride (1:2) is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of saturated carbon atoms within its ring system. The aminoethyl side chain contributes to its potential biological activity, suggesting that it may interact with various biological targets. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the methyl group further influences its chemical properties and reactivity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific interactions and effects would require further investigation through experimental studies to elucidate its potential applications in drug development or other fields.
Formula:C11H17N3O·2ClH
InChI:InChI=1S/C11H17N3O.2ClH/c1-8-9(5-6-12)11(15)14-7-3-2-4-10(14)13-8;;/h2-7,12H2,1H3;2*1H
InChI key:InChIKey=ZOOHUVPZIRFOEM-UHFFFAOYSA-N
SMILES:O=C1N2C(=NC(C)=C1CCN)CCCC2.Cl
Synonyms:
  • 4H-Pyrido[1,2-a]pyrimidin-4-one, 3-(2-aminoethyl)-6,7,8,9-tetrahydro-2-methyl-, hydrochloride (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.