CAS 13335-73-4
:2-(3,4-Dimethylphenoxy)acetic acid
Description:
2-(3,4-Dimethylphenoxy)acetic acid, with the CAS number 13335-73-4, is an organic compound characterized by its aromatic structure and carboxylic acid functional group. It features a phenoxy group, which is a phenyl ring substituted with two methyl groups at the 3 and 4 positions, attached to an acetic acid moiety. This compound is typically a white to off-white solid and is soluble in organic solvents, while its solubility in water may vary. It is known for its applications in the field of herbicides, particularly as a plant growth regulator, influencing various physiological processes in plants. The presence of the dimethylphenyl group enhances its biological activity and selectivity. Additionally, like many phenoxyacetic acids, it may exhibit properties such as auxin-like activity, which can affect plant growth and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity and environmental impact.
Formula:C10H12O3
InChI:InChI=1S/C10H12O3/c1-7-3-4-9(5-8(7)2)13-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)
InChI key:InChIKey=GIEQJKZWTIFEJM-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=CC(C)=C(C)C=C1
Synonyms:- (3,4-Dimethylphenoxy)Acetic Acid
- 2-(3,4-Dimethylphenoxy)acetic acid
- 2-[(3,4-Dimethylphenyl)oxy]acetic acid
- Acetic acid, (3,4-dimethylphenoxy)-
- Acetic acid, (3,4-xylyloxy)-
- Acetic acid, 2-(3,4-dimethylphenoxy)-
- Ai3-16549
- NSC 408600
- [(3,4-Dimethylphenyl)oxy]acetic acid
- 3,4-Xylyloxyacetic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Acetic acid, 2-(3,4-dimethylphenoxy)-
CAS:Formula:C10H12O3Purity:97%Color and Shape:SolidMolecular weight:180.20053,4-Dimethylphenoxyacetic acid
CAS:3,4-Dimethylphenoxyacetic acidPurity:95%Molecular weight:180.20g/mol3,4-Dimethylphenoxyacetic acid
CAS:3,4-Dimethylphenoxyacetic acid is a versatile building block that is used in the synthesis of complex compounds. It is often used as a reagent and has been shown to be useful in the synthesis of high quality and useful intermediates. 3,4-Dimethylphenoxyacetic acid can also be used as a reaction component or scaffold for further chemical reactions.Formula:C10H12O3Purity:Min. 95%Molecular weight:180.2 g/mol3,4-Dimethylphenoxyacetic acid
CAS:Formula:C10H12O3Purity:97%Color and Shape:SolidMolecular weight:180.203



