CAS 133352-26-8
:cyclothiazomycin
Description:
Cyclothiazomycin is a naturally occurring antibiotic that belongs to the class of thiazole-containing compounds. It is primarily known for its antibacterial properties, particularly against Gram-positive bacteria. The compound features a unique bicyclic structure that includes a thiazole ring, which contributes to its biological activity. Cyclothiazomycin functions by inhibiting bacterial protein synthesis, making it effective in treating various bacterial infections. Its mechanism of action involves binding to the ribosomal RNA, disrupting the translation process. The substance is typically characterized by its moderate solubility in organic solvents and limited solubility in water, which can influence its bioavailability and pharmacokinetics. Additionally, cyclothiazomycin has been studied for its potential applications in agriculture as a fungicide and in the development of new therapeutic agents. Due to its specific mode of action and structural features, it continues to be of interest in medicinal chemistry and microbiology research.
Formula:C59H64N18O14S7
InChI:InChI=1/C59H64N18O14S7/c1-7-27-47(85)76-59(6)58(91)75-42(25(5)78)49(87)61-15-40(80)64-28(8-2)56(88)77-13-9-10-38(77)48(86)62-23(3)41-26(43(81)67-30(14-39(60)79)52-69-32(17-93-52)45(83)66-27)11-12-29(65-41)51-73-35(20-96-51)53-70-31(16-94-53)44(82)63-24(4)50-72-34(19-92-50)55-74-36(21-97-55)54-71-33(18-95-54)46(84)68-37(22-98-59)57(89)90/h7-8,11-12,19-21,23,25,30-33,37-38,42,78H,4,9-10,13-18,22H2,1-3,5-6H3,(H2,60,79)(H,61,87)(H,62,86)(H,63,82)(H,64,80)(H,66,83)(H,67,81)(H,68,84)(H,75,91)(H,76,85)(H,89,90)/b27-7-,28-8-/t23-,25-,30+,31+,32+,33+,37+,38+,42+,59+/m1/s1
Synonyms:- Cyclo[2-mercapto-D-alanyl-L-threonylglycyl-(2Z)-2-amino-2-butenoyl-L-prolyl-2-[(1R)-1-aminoethyl]-6-[(4R)-4-[[[1-[(4R)-4-[[[(1R)-1-carboxy-2-mercaptoethyl]amino]carbonyl]-4,5-dihydro[2,4':2',4''-terthiazol]-2''-yl]ethenyl]amino]carbonyl]-4,5-dihydro[2,4'-bithiazol]-2'-yl]-3-pyridinecarbonyl-(4R)-2-[...
- Cyclothiazomycin
- cyclothiazomycin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cyclothiazomycin
CAS:Cyclothiazomycin selectively inhibits renin activity without affecting pepsin, aspartic, serine, thiol, and metalloproteases. Additionally, Cyclothiazomycin exhibits weak antifungal activity.Formula:C59H64N18O14S7Color and Shape:SolidMolecular weight:1473.71
