CAS 133359-80-5
:(3S)-3-(2-Thienylthio)butanoic acid
Description:
(3S)-3-(2-Thienylthio)butanoic acid is an organic compound characterized by its thienylthio group, which imparts unique properties to the molecule. This compound features a butanoic acid backbone, with a sulfur-containing thienyl group attached at the 3-position. The presence of the thienyl moiety contributes to its potential reactivity and solubility in various organic solvents. The stereochemistry indicated by the (3S) designation suggests that the compound has a specific three-dimensional arrangement, which can influence its biological activity and interactions with other molecules. Generally, compounds like this may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Overall, (3S)-3-(2-Thienylthio)butanoic acid is a compound of interest for further study in both synthetic and medicinal chemistry contexts.
Formula:C8H10O2S2
InChI:InChI=1S/C8H10O2S2/c1-6(5-7(9)10)12-8-3-2-4-11-8/h2-4,6H,5H2,1H3,(H,9,10)/t6-/m0/s1
InChI key:InChIKey=SIFFRIHCTBGQTC-LURJTMIESA-N
SMILES:S([C@H](CC(O)=O)C)C1=CC=CS1
Synonyms:- (3S)-3-(Thiophen-2-ylsulfanyl)butanoic acid
- Butanoic acid, 3-(2-thienylthio)-, (3S)-
- Butanoic acid, 3-(2-thienylthio)-, (S)-
- (S)-3-(Thiophen-2-ylthio)butanoicacid
- (3S)-3-(2-Thienylthio)butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
